CymitQuimica logo

CAS 937601-61-1

:

4,5,6,7-Tetrahydro-3-(trifluoromethyl)-1H-indazole-1-propanenitrile

Description:
4,5,6,7-Tetrahydro-3-(trifluoromethyl)-1H-indazole-1-propanenitrile is a chemical compound characterized by its unique indazole structure, which features a bicyclic system containing a five-membered ring fused to a six-membered ring. The presence of a trifluoromethyl group (-CF3) enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The propanenitrile functional group (-C≡N) contributes to its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the trifluoromethyl group is known to impart unique electronic properties, which can affect the compound's interaction with biological targets. Safety and handling precautions should be observed, as with many fluorinated compounds, due to potential toxicity and environmental concerns.
Formula:C11H12F3N3
InChI:InChI=1S/C11H12F3N3/c12-11(13,14)10-8-4-1-2-5-9(8)17(16-10)7-3-6-15/h1-5,7H2
InChI key:InChIKey=JHCGTSJCBNDFSM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(N(CCC#N)N1)CCCC2
Synonyms:
  • 1H-Indazole-1-propanenitrile, 4,5,6,7-tetrahydro-3-(trifluoromethyl)-
  • 4,5,6,7-Tetrahydro-3-(trifluoromethyl)-1H-indazole-1-propanenitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.