CAS 937602-01-2
:4-Amino-N-phenyl-1-piperidinecarboxamide
Description:
4-Amino-N-phenyl-1-piperidinecarboxamide is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an amino group (-NH2) and a phenyl group attached to the piperidine structure, contributing to its potential biological activity. The presence of the carboxamide functional group (-C(=O)NH2) enhances its solubility in polar solvents and may influence its interaction with biological targets. The molecular structure suggests that it could participate in hydrogen bonding, which is significant for its pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with various biological pathways. Its CAS number, 937602-01-2, allows for easy identification in chemical databases and literature. Overall, 4-Amino-N-phenyl-1-piperidinecarboxamide exhibits characteristics typical of amides and piperidine derivatives, making it a subject of interest for further research and application in drug development.
Formula:C12H17N3O
InChI:InChI=1/C12H17N3O/c13-10-6-8-15(9-7-10)12(16)14-11-4-2-1-3-5-11/h1-5,10H,6-9,13H2,(H,14,16)
InChI key:InChIKey=HNDPILCFPCXRSC-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)N2CCC(N)CC2
Synonyms:- 1-piperidinecarboxamide, 4-amino-N-phenyl-
- 4-Amino-N-phenyl-1-piperidinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.