
CAS 937602-12-5
:2-Bromo-1,3-bis(3-bromophenyl)-1,3-propanedione
Description:
2-Bromo-1,3-bis(3-bromophenyl)-1,3-propanedione is an organic compound characterized by its structure, which includes two bromophenyl groups attached to a central propanedione moiety. This compound features a diketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of bromine atoms enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound is likely to exhibit moderate to high lipophilicity due to the presence of multiple aromatic rings, which can influence its solubility in organic solvents. Additionally, the bromine substituents may impart unique electronic properties, affecting its behavior in photochemical processes. As with many brominated compounds, it is essential to consider its environmental impact and potential toxicity. Overall, 2-Bromo-1,3-bis(3-bromophenyl)-1,3-propanedione serves as a valuable intermediate in the synthesis of more complex organic molecules and may have applications in materials science and medicinal chemistry.
Formula:C15H9Br3O2
InChI:InChI=1S/C15H9Br3O2/c16-11-5-1-3-9(7-11)14(19)13(18)15(20)10-4-2-6-12(17)8-10/h1-8,13H
InChI key:InChIKey=HKXXTAAPFWIEAS-UHFFFAOYSA-N
SMILES:C(C(C(=O)C1=CC(Br)=CC=C1)Br)(=O)C2=CC(Br)=CC=C2
Synonyms:- 2-Bromo-1,3-bis(3-bromophenyl)-1,3-propanedione
- 1,3-Propanedione, 2-bromo-1,3-bis(3-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.