CAS 937602-16-9

2-Bromo-1,3-bis(3,4-dimethylphenyl)-1,3-propanedione

Description:

2-Bromo-1,3-bis(3,4-dimethylphenyl)-1,3-propanedione is an organic compound characterized by its complex structure, which includes a bromine atom and two 3,4-dimethylphenyl groups attached to a central propanedione moiety. This compound typically exhibits properties associated with diketones, such as being a potential precursor in organic synthesis and having applications in materials science and pharmaceuticals. The presence of the bromine atom can enhance its reactivity, making it useful in various chemical reactions, including substitution and coupling reactions. The bulky 3,4-dimethylphenyl groups contribute to its steric hindrance, which may influence its solubility and reactivity in different solvents. Additionally, the compound may display interesting optical properties due to its conjugated system, making it a candidate for studies in photochemistry. Overall, 2-Bromo-1,3-bis(3,4-dimethylphenyl)-1,3-propanedione is a versatile compound with potential applications in diverse fields of chemistry.

Formula: C₁₉H₁₉BrO₂

InChI: InChI=1S/C19H19BrO2/c1-11-5-7-15(9-13(11)3)18(21)17(20)19(22)16-8-6-12(2)14(4)10-16/h5-10,17H,1-4H3

InChI key: InChIKey=WLZVCCHMZDWYDQ-UHFFFAOYSA-N

SMILES: C(C(C(=O)C1=CC(C)=C(C)C=C1)Br)(=O)C2=CC(C)=C(C)C=C2

Synonyms:

• 2-Bromo-1,3-bis(3,4-dimethylphenyl)-1,3-propanedione
• 1,3-Propanedione, 2-bromo-1,3-bis(3,4-dimethylphenyl)-