CAS 937602-22-7
:2-Chloro-1,3-bis(4-fluorophenyl)-1,3-propanedione
Description:
2-Chloro-1,3-bis(4-fluorophenyl)-1,3-propanedione, identified by its CAS number 937602-22-7, is an organic compound characterized by its unique structure featuring a propanedione backbone substituted with two 4-fluorophenyl groups and a chlorine atom. This compound typically exhibits properties associated with diketones, including potential reactivity in nucleophilic addition reactions due to the presence of the carbonyl groups. The presence of the chlorine and fluorine substituents can influence its electronic properties, making it a candidate for various applications in medicinal chemistry and materials science. The fluorine atoms may enhance lipophilicity and biological activity, while the chlorine atom can affect the compound's stability and reactivity. Additionally, this compound may exhibit interesting optical properties and could be explored for use in organic synthesis or as a building block in the development of pharmaceuticals. Safety and handling precautions should be observed due to the presence of halogenated substituents, which can pose environmental and health risks.
Formula:C15H9ClF2O2
InChI:InChI=1S/C15H9ClF2O2/c16-13(14(19)9-1-5-11(17)6-2-9)15(20)10-3-7-12(18)8-4-10/h1-8,13H
InChI key:InChIKey=YPLYWTHKDYOEET-UHFFFAOYSA-N
SMILES:C(C(C(=O)C1=CC=C(F)C=C1)Cl)(=O)C2=CC=C(F)C=C2
Synonyms:- 1,3-Propanedione, 2-chloro-1,3-bis(4-fluorophenyl)-
- 2-Chloro-1,3-bis(4-fluorophenyl)-1,3-propanedione
- 2-chloro-1,3-bis(4-fluorophenyl)propane-1,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.