CymitQuimica logo

CAS 937602-26-1

:

Ethyl 1,2-dihydro-7-methyl-2-oxopyrazolo[1,5-a]pyridine-6-carboxylate

Description:
Ethyl 1,2-dihydro-7-methyl-2-oxopyrazolo[1,5-a]pyridine-6-carboxylate is a chemical compound characterized by its unique pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and varied reactivity due to the presence of functional groups like the carboxylate ester. The ethyl ester group contributes to its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The presence of the methyl group at the 7-position of the pyrazolo ring may influence its pharmacological properties, potentially enhancing its interaction with biological targets. Additionally, the compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which are common in the chemistry of heterocycles. Overall, this compound represents a class of molecules that are of interest for their potential therapeutic applications and as intermediates in synthetic chemistry.
Formula:C11H12N2O3
InChI:InChI=1S/C11H12N2O3/c1-3-16-11(15)9-5-4-8-6-10(14)12-13(8)7(9)2/h4-6H,3H2,1-2H3,(H,12,14)
InChI key:InChIKey=XPQGIAIBXGRBGA-UHFFFAOYSA-N
SMILES:CC=1N2C(C=CC1C(OCC)=O)=CC(=O)N2
Synonyms:
  • Pyrazolo[1,5-a]pyridine-6-carboxylic acid, 1,2-dihydro-7-methyl-2-oxo-, ethyl ester
  • Ethyl 1,2-dihydro-7-methyl-2-oxopyrazolo[1,5-a]pyridine-6-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.