CAS 937602-32-9
:2-Bromo-1,3-bis(2-methoxyphenyl)-1,3-propanedione
Description:
2-Bromo-1,3-bis(2-methoxyphenyl)-1,3-propanedione is an organic compound characterized by its unique structure, which includes a bromine atom and two methoxy-substituted phenyl groups attached to a central propanedione moiety. This compound typically exhibits properties associated with diketones, such as the ability to undergo enolization, which can influence its reactivity and stability. The presence of the bromine atom may enhance its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methoxy groups contribute to the compound's solubility in organic solvents and can also affect its electronic properties, potentially influencing its interactions in biological systems. Additionally, the compound may exhibit interesting optical properties due to its conjugated system, making it of interest in fields such as materials science and medicinal chemistry. Overall, 2-Bromo-1,3-bis(2-methoxyphenyl)-1,3-propanedione is a versatile compound with potential applications in synthetic organic chemistry and drug development.
Formula:C17H15BrO4
InChI:InChI=1S/C17H15BrO4/c1-21-13-9-5-3-7-11(13)16(19)15(18)17(20)12-8-4-6-10-14(12)22-2/h3-10,15H,1-2H3
InChI key:InChIKey=TVHHEOOATVXOLP-UHFFFAOYSA-N
SMILES:C(C(C(=O)C1=C(OC)C=CC=C1)Br)(=O)C2=C(OC)C=CC=C2
Synonyms:- 2-Bromo-1,3-bis(2-methoxyphenyl)-1,3-propanedione
- 1,3-Propanedione, 2-bromo-1,3-bis(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.