CAS 937602-34-1
:2-Chloro-1,3-bis(2-methoxyphenyl)-1,3-propanedione
Description:
2-Chloro-1,3-bis(2-methoxyphenyl)-1,3-propanedione, identified by its CAS number 937602-34-1, is an organic compound characterized by its unique structure, which includes a chloro substituent and two methoxyphenyl groups attached to a central propanedione moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in organic synthesis and medicinal chemistry due to its functional groups that may engage in various chemical reactions. The presence of the chloro group can enhance its reactivity, while the methoxyphenyl groups may contribute to its solubility and interaction with biological targets. Additionally, the compound may display interesting optical properties and could be studied for its potential as a ligand in coordination chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest in both academic and industrial research settings.
Formula:C17H15ClO4
InChI:InChI=1S/C17H15ClO4/c1-21-13-9-5-3-7-11(13)16(19)15(18)17(20)12-8-4-6-10-14(12)22-2/h3-10,15H,1-2H3
InChI key:InChIKey=LGKSTNVXEBFBSL-UHFFFAOYSA-N
SMILES:C(C(C(=O)C1=C(OC)C=CC=C1)Cl)(=O)C2=C(OC)C=CC=C2
Synonyms:- 2-Chloro-1,3-bis(2-methoxyphenyl)-1,3-propanedione
- 1,3-Propanedione, 2-chloro-1,3-bis(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.