CAS 937602-42-1

2-[3-Fluoro-4-(trifluoromethyl)phenyl]-4-thiazoleacetic acid

Description:

2-[3-Fluoro-4-(trifluoromethyl)phenyl]-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a phenyl group substituted with both a fluorine atom and a trifluoromethyl group. This compound is likely to exhibit significant lipophilicity due to the presence of multiple fluorine atoms, which can influence its solubility and biological activity. The thiazole moiety contributes to its potential as a bioactive molecule, possibly exhibiting antimicrobial or anti-inflammatory properties. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions, making it a potential candidate for various chemical syntheses or pharmaceutical applications. Additionally, the specific arrangement of substituents may affect its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique characteristics position it as a subject of interest for further research in both synthetic and medicinal chemistry contexts.

Formula: C₁₂H₇F₄NO₂S

InChI: InChI=1S/C12H7F4NO2S/c13-9-3-6(1-2-8(9)12(14,15)16)11-17-7(5-20-11)4-10(18)19/h1-3,5H,4H2,(H,18,19)

InChI key: InChIKey=UKVOEFKMYPJICK-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C(F)(F)F)C2=NC(CC(O)=O)=CS2

Synonyms:

• 2-[3-Fluoro-4-(trifluoromethyl)phenyl]-4-thiazoleacetic acid
• 4-Thiazoleacetic acid, 2-[3-fluoro-4-(trifluoromethyl)phenyl]-

{2-[3-Fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl}acetic acid

CAS: 937602-42-1

{2-[3-Fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl}acetic acid

Purity: 95%

Molecular weight: 305.25g/mol

Ref: 54-PC8591