CAS 937602-43-2

2-[3-Fluoro-4-(trifluoromethyl)phenyl]-4-thiazolecarboxylic acid

Description:

2-[3-Fluoro-4-(trifluoromethyl)phenyl]-4-thiazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a phenyl group substituted with both a fluorine atom and a trifluoromethyl group. This compound is likely to exhibit properties typical of thiazole derivatives, such as potential biological activity, including antimicrobial or anti-inflammatory effects, due to the presence of the carboxylic acid functional group. The trifluoromethyl group is known to enhance lipophilicity and metabolic stability, which can influence the compound's pharmacokinetics. Additionally, the presence of fluorine atoms can affect the compound's electronic properties and reactivity. The molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which could be relevant in its applications in medicinal chemistry or material science. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and pharmaceutical fields.

Formula: C₁₁H₅F₄NO₂S

InChI: InChI=1S/C11H5F4NO2S/c12-7-3-5(1-2-6(7)11(13,14)15)9-16-8(4-19-9)10(17)18/h1-4H,(H,17,18)

InChI key: InChIKey=WNAGSVOVHQPALY-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N=C(SC1)C2=CC(F)=C(C(F)(F)F)C=C2

Synonyms:

• 4-Thiazolecarboxylic acid, 2-[3-fluoro-4-(trifluoromethyl)phenyl]-
• 2-[3-Fluoro-4-(trifluoromethyl)phenyl]-4-thiazolecarboxylic acid

2-[3-Fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid

CAS: 937602-43-2

2-[3-Fluoro-4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid

Purity: 95%

Molecular weight: 291.22g/mol

Ref: 54-PC8590