CymitQuimica logo

CAS 937603-85-5

:

6-(3,4-Dihydro-1(2H)-quinolinyl)-3-pyridinamine

Description:
6-(3,4-Dihydro-1(2H)-quinolinyl)-3-pyridinamine, with the CAS number 937603-85-5, is a chemical compound that features a fused bicyclic structure combining a quinoline and a pyridine moiety. This compound is characterized by its nitrogen-containing heterocycles, which contribute to its potential biological activity. The presence of the amine functional group enhances its solubility in polar solvents and may facilitate interactions with biological targets, making it of interest in medicinal chemistry. The compound's structural features suggest it could exhibit properties such as antimicrobial or anticancer activity, although specific biological data would be necessary to confirm these effects. Additionally, the compound's stability, reactivity, and potential applications in drug development would depend on its specific molecular interactions and the presence of substituents that can influence its pharmacokinetic and pharmacodynamic profiles. Overall, 6-(3,4-Dihydro-1(2H)-quinolinyl)-3-pyridinamine represents a class of compounds that may hold promise for further research in therapeutic applications.
Formula:C14H15N3
InChI:InChI=1S/C14H15N3/c15-12-7-8-14(16-10-12)17-9-3-5-11-4-1-2-6-13(11)17/h1-2,4,6-8,10H,3,5,9,15H2
InChI key:InChIKey=QPGPWDYYRQUBJT-UHFFFAOYSA-N
SMILES:NC1=CC=C(N2C=3C(CCC2)=CC=CC3)N=C1
Synonyms:
  • 6-(3,4-Dihydro-1(2H)-quinolinyl)-3-pyridinamine
  • 3-Pyridinamine, 6-(3,4-dihydro-1(2H)-quinolinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.