CAS 937603-91-3

6-(1H-Benzimidazol-1-yl)-3-pyridinamine

Description:

6-(1H-Benzimidazol-1-yl)-3-pyridinamine, identified by its CAS number 937603-91-3, is a chemical compound that features a benzimidazole moiety linked to a pyridinamine structure. This compound typically exhibits characteristics common to heterocyclic compounds, including potential biological activity due to the presence of nitrogen atoms in its rings, which can participate in hydrogen bonding and coordination with metal ions. The benzimidazole part is known for its role in various pharmacological applications, including anti-cancer and anti-inflammatory activities. The pyridinamine component may contribute to the compound's solubility and reactivity. In terms of physical properties, it is likely to be a solid at room temperature, with specific melting and boiling points that would depend on its molecular interactions. The compound's functional groups suggest it may engage in various chemical reactions, making it of interest in medicinal chemistry and drug development. Overall, its unique structure positions it as a candidate for further research in therapeutic applications.

Formula: C₁₂H₁₀N₄

InChI: InChI=1S/C12H10N4/c13-9-5-6-12(14-7-9)16-8-15-10-3-1-2-4-11(10)16/h1-8H,13H2

InChI key: InChIKey=ZHJWNZRJIFJECV-UHFFFAOYSA-N

SMILES: NC1=CC=C(N2C=3C(N=C2)=CC=CC3)N=C1

Synonyms:

• 6-(1H-Benzimidazol-1-yl)-3-pyridinamine
• 3-Pyridinamine, 6-(1H-benzimidazol-1-yl)-

6-(1H-1,3-Benzodiazol-1-yl)pyridin-3-amine

CAS: 937603-91-3

Versatile small molecule scaffold

Formula: C₁₂H₁₀N₄

Purity: Min. 95%

Molecular weight: 210.23 g/mol

Ref: 3D-MMB60391