CymitQuimica logo

CAS 937604-07-4

:

3-Chloro-2-[4-(phenylmethyl)-1-piperazinyl]benzenamine

Description:
3-Chloro-2-[4-(phenylmethyl)-1-piperazinyl]benzenamine, identified by its CAS number 937604-07-4, is a chemical compound that features a complex structure characterized by a chlorinated aromatic ring and a piperazine moiety. The presence of the chloro group at the 3-position of the benzene ring contributes to its reactivity and potential biological activity. The piperazine ring, substituted with a phenylmethyl group, enhances the compound's ability to interact with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. This compound may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential interactions with various receptors or enzymes due to its structural features. Its specific applications and effects would depend on further studies, including pharmacological evaluations and toxicity assessments. Overall, 3-Chloro-2-[4-(phenylmethyl)-1-piperazinyl]benzenamine represents a class of compounds that could be explored for therapeutic uses, particularly in areas related to neuropharmacology or other medicinal applications.
Formula:C17H20ClN3
InChI:InChI=1S/C17H20ClN3/c18-15-7-4-8-16(19)17(15)21-11-9-20(10-12-21)13-14-5-2-1-3-6-14/h1-8H,9-13,19H2
InChI key:InChIKey=GRLQOSNKGVWZQJ-UHFFFAOYSA-N
SMILES:ClC1=C(N2CCN(CC3=CC=CC=C3)CC2)C(N)=CC=C1
Synonyms:
  • 3-Chloro-2-[4-(phenylmethyl)-1-piperazinyl]benzenamine
  • Benzenamine, 3-chloro-2-[4-(phenylmethyl)-1-piperazinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.