CAS 937604-08-5
:4-[2-[4-(Phenylmethyl)-1-piperazinyl]ethoxy]benzoic acid
Description:
4-[2-[4-(Phenylmethyl)-1-piperazinyl]ethoxy]benzoic acid, with the CAS number 937604-08-5, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety linked to a piperazine ring through an ethoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It may possess moderate solubility in organic solvents and limited solubility in water, influenced by the presence of the hydrophobic phenylmethyl group and the hydrophilic carboxylic acid functional group. The piperazine ring is known for its role in pharmacology, often contributing to the compound's interaction with biological targets, such as receptors or enzymes. The presence of the ethoxy group may enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders or other therapeutic areas.
Formula:C20H24N2O3
InChI:InChI=1S/C20H24N2O3/c23-20(24)18-6-8-19(9-7-18)25-15-14-21-10-12-22(13-11-21)16-17-4-2-1-3-5-17/h1-9H,10-16H2,(H,23,24)
InChI key:InChIKey=FHKCDFWFVFSPQP-UHFFFAOYSA-N
SMILES:C(N1CCN(CCOC2=CC=C(C(O)=O)C=C2)CC1)C3=CC=CC=C3
Synonyms:- Benzoic acid, 4-[2-[4-(phenylmethyl)-1-piperazinyl]ethoxy]-
- 4-[2-[4-(Phenylmethyl)-1-piperazinyl]ethoxy]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.