CAS 937604-10-9
:4-[2-[4-(Phenylmethyl)-1-piperazinyl]ethoxy]benzoic acid hydrazide
Description:
4-[2-[4-(Phenylmethyl)-1-piperazinyl]ethoxy]benzoic acid hydrazide is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety, a hydrazide functional group, and a piperazine ring substituted with a phenylmethyl group. This compound typically exhibits properties associated with both hydrazides and piperazines, such as potential biological activity, including antimicrobial or antitumor effects, due to the presence of the piperazine ring, which is known for its pharmacological significance. The ethoxy group enhances its solubility and may influence its interaction with biological targets. The compound's hydrazide functionality can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which could affect its physical properties, such as melting point and solubility in different solvents. Overall, this compound's unique structural features may contribute to its utility in medicinal chemistry and drug development.
Formula:C20H26N4O2
InChI:InChI=1S/C20H26N4O2/c21-22-20(25)18-6-8-19(9-7-18)26-15-14-23-10-12-24(13-11-23)16-17-4-2-1-3-5-17/h1-9H,10-16,21H2,(H,22,25)
InChI key:InChIKey=ZDQDJHRVHLTWOB-UHFFFAOYSA-N
SMILES:C(N1CCN(CCOC2=CC=C(C(NN)=O)C=C2)CC1)C3=CC=CC=C3
Synonyms:- 4-[2-[4-(Phenylmethyl)-1-piperazinyl]ethoxy]benzoic acid hydrazide
- Benzoic acid, 4-[2-[4-(phenylmethyl)-1-piperazinyl]ethoxy]-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.