CAS 937604-18-7

2-[4-(2-Bromoethoxy)phenyl]thiazolidine

Description:

2-[4-(2-Bromoethoxy)phenyl]thiazolidine is a chemical compound characterized by its thiazolidine ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. The presence of the 2-bromoethoxy group attached to a phenyl ring contributes to its unique reactivity and potential applications in medicinal chemistry. This compound may exhibit various biological activities due to the thiazolidine core, which is often associated with anti-inflammatory and antidiabetic properties. The bromine atom in the ethoxy substituent can enhance the compound's reactivity, making it a useful intermediate in organic synthesis. Additionally, the compound's solubility, stability, and interaction with biological targets can be influenced by the functional groups present. As with many thiazolidine derivatives, it may also be of interest in the development of pharmaceuticals, particularly in the context of drug design and discovery. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.

Formula: C₁₁H₁₄BrNOS

InChI: InChI=1S/C11H14BrNOS/c12-5-7-14-10-3-1-9(2-4-10)11-13-6-8-15-11/h1-4,11,13H,5-8H2

InChI key: InChIKey=BKAUWTAOEQBMRE-UHFFFAOYSA-N

SMILES: O(CCBr)C1=CC=C(C=C1)C2NCCS2

Synonyms:

• Thiazolidine, 2-[4-(2-bromoethoxy)phenyl]-
• 2-[4-(2-Bromoethoxy)phenyl]thiazolidine