
CAS 937604-33-6
:3-Chloro-2-(3,4-dihydro-1(2H)-quinolinyl)benzenamine
Description:
3-Chloro-2-(3,4-dihydro-1(2H)-quinolinyl)benzenamine is an organic compound characterized by its complex structure, which includes a chloro substituent and a quinoline moiety. The presence of the chloro group indicates that it is likely to exhibit moderate reactivity, particularly in nucleophilic substitution reactions. The quinoline structure contributes to its potential biological activity, as many compounds containing quinoline derivatives are known for their pharmacological properties, including antimicrobial and antitumor activities. The amine functional group in the benzenamine part of the molecule suggests that it can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. Additionally, the compound's molecular geometry and electronic properties may affect its stability and reactivity. Overall, 3-Chloro-2-(3,4-dihydro-1(2H)-quinolinyl)benzenamine is a compound of interest in medicinal chemistry, with potential applications in drug development and synthesis.
Formula:C15H15ClN2
InChI:InChI=1S/C15H15ClN2/c16-12-7-3-8-13(17)15(12)18-10-4-6-11-5-1-2-9-14(11)18/h1-3,5,7-9H,4,6,10,17H2
InChI key:InChIKey=HVRZBLYYODCGLT-UHFFFAOYSA-N
SMILES:ClC1=C(N2C=3C(CCC2)=CC=CC3)C(N)=CC=C1
Synonyms:- 3-Chloro-2-(3,4-dihydro-1(2H)-quinolinyl)benzenamine
- Benzenamine, 3-chloro-2-(3,4-dihydro-1(2H)-quinolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.