CAS 937604-57-4

3-Chloro-2-(3-fluorophenoxy)benzenamine

Description:

3-Chloro-2-(3-fluorophenoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a chloro group, an amino group, and a phenoxy moiety. The presence of the chloro substituent at the 3-position and the fluorophenoxy group at the 2-position of the benzene ring contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound is likely to exhibit moderate polarity due to the presence of both the amino and phenoxy functional groups, which can engage in hydrogen bonding. Its fluorine atom may enhance lipophilicity and influence biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of targeted therapies or as intermediates in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.

Formula: C₁₂H₉ClFNO

InChI: InChI=1S/C12H9ClFNO/c13-10-5-2-6-11(15)12(10)16-9-4-1-3-8(14)7-9/h1-7H,15H2

InChI key: InChIKey=MZZRTUWQMILEDU-UHFFFAOYSA-N

SMILES: O(C1=C(Cl)C=CC=C1N)C2=CC(F)=CC=C2

Synonyms:

• 3-Chloro-2-(3-fluorophenoxy)benzenamine
• Benzenamine, 3-chloro-2-(3-fluorophenoxy)-