
CAS 937604-59-6
:3-Chloro-2-(2,4-dimethylphenoxy)benzenamine
Description:
3-Chloro-2-(2,4-dimethylphenoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a chloro substituent and an amine functional group. The presence of the chloro group introduces reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The dimethylphenoxy moiety contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests that it could participate in hydrogen bonding due to the amine group, which may affect its physical properties, such as melting and boiling points. Additionally, the presence of multiple functional groups can lead to diverse reactivity patterns, making it of interest in synthetic organic chemistry. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental impact.
Formula:C14H14ClNO
InChI:InChI=1S/C14H14ClNO/c1-9-6-7-13(10(2)8-9)17-14-11(15)4-3-5-12(14)16/h3-8H,16H2,1-2H3
InChI key:InChIKey=RPAHTZZPAGNAOZ-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=CC=C1N)C2=C(C)C=C(C)C=C2
Synonyms:- Benzenamine, 3-chloro-2-(2,4-dimethylphenoxy)-
- 3-Chloro-2-(2,4-dimethylphenoxy)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.