
CAS 937604-61-0
:3-Chloro-2-(2,5-dimethylphenoxy)benzenamine
Description:
3-Chloro-2-(2,5-dimethylphenoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a chloro substituent and an amine functional group. The presence of the chloro group indicates that it is a chlorinated aromatic compound, which can influence its reactivity and solubility. The compound features a phenoxy group, which is derived from phenol, indicating potential applications in various chemical reactions, including nucleophilic substitutions. The dimethyl groups on the phenoxy ring contribute to the compound's steric hindrance and may affect its electronic properties, potentially enhancing its reactivity in certain contexts. This compound may be of interest in pharmaceutical or agrochemical research due to its structural characteristics, which could impart specific biological activities. Additionally, the presence of both the amine and chloro groups suggests that it could participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties such as melting point, boiling point, and solubility in different solvents. Overall, 3-Chloro-2-(2,5-dimethylphenoxy)benzenamine is a complex molecule with potential utility in various chemical applications.
Formula:C14H14ClNO
InChI:InChI=1S/C14H14ClNO/c1-9-6-7-10(2)13(8-9)17-14-11(15)4-3-5-12(14)16/h3-8H,16H2,1-2H3
InChI key:InChIKey=WYZICDJWUSDNRO-UHFFFAOYSA-N
SMILES:O(C1=C(C)C=CC(C)=C1)C2=C(Cl)C=CC=C2N
Synonyms:- Benzenamine, 3-chloro-2-(2,5-dimethylphenoxy)-
- 3-Chloro-2-(2,5-dimethylphenoxy)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.