
CAS 937604-71-2
:3-Chloro-2-(2-methoxy-4-methylphenoxy)benzenamine
Description:
3-Chloro-2-(2-methoxy-4-methylphenoxy)benzenamine, with the CAS number 937604-71-2, is an organic compound characterized by its complex aromatic structure. It features a chloro substituent and an amine group, which contribute to its reactivity and potential applications in various chemical reactions. The presence of the methoxy and methyl groups on the phenyl ring enhances its lipophilicity, which may influence its solubility and biological activity. This compound is likely to exhibit properties typical of aromatic amines, such as the ability to participate in electrophilic substitution reactions. Additionally, the chlorine atom may introduce unique reactivity patterns, making it a candidate for further functionalization. Its structural characteristics suggest potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed due to the presence of chlorine and amine functionalities, which can pose health risks. Overall, 3-Chloro-2-(2-methoxy-4-methylphenoxy)benzenamine is a versatile compound with significant implications in chemical research and industry.
Formula:C14H14ClNO2
InChI:InChI=1S/C14H14ClNO2/c1-9-6-7-12(13(8-9)17-2)18-14-10(15)4-3-5-11(14)16/h3-8H,16H2,1-2H3
InChI key:InChIKey=DGNQCRDHJGQQOF-UHFFFAOYSA-N
SMILES:O(C1=C(OC)C=C(C)C=C1)C2=C(Cl)C=CC=C2N
Synonyms:- Benzenamine, 3-chloro-2-(2-methoxy-4-methylphenoxy)-
- 3-Chloro-2-(2-methoxy-4-methylphenoxy)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.