CAS 937605-28-2

3-[(1-Oxo-2-phenyl-1H-inden-3-yl)amino]benzoic acid

Description:

3-[(1-Oxo-2-phenyl-1H-inden-3-yl)amino]benzoic acid, identified by its CAS number 937605-28-2, is a chemical compound that features a complex structure combining an indene derivative with an amino group and a carboxylic acid functionality. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in medicinal chemistry due to its unique structural features that may influence biological activity. The presence of the phenyl group suggests potential for aromatic interactions, while the carboxylic acid moiety can participate in hydrogen bonding and contribute to solubility in polar solvents. The compound's reactivity may be influenced by the electron-withdrawing and electron-donating effects of its substituents, making it a candidate for further study in drug development or as a biochemical probe. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be assessed under various conditions to understand its potential applications.

Formula: C₂₂H₁₅NO₃

InChI: InChI=1S/C22H15NO3/c24-21-18-12-5-4-11-17(18)20(19(21)14-7-2-1-3-8-14)23-16-10-6-9-15(13-16)22(25)26/h1-13,23H,(H,25,26)

InChI key: InChIKey=GJXMBHZXMBMICV-UHFFFAOYSA-N

SMILES: N(C1=C(C(=O)C=2C1=CC=CC2)C3=CC=CC=C3)C4=CC(C(O)=O)=CC=C4

Synonyms:

• 3-[(1-Oxo-2-phenyl-1H-inden-3-yl)amino]benzoic acid
• Benzoic acid, 3-[(1-oxo-2-phenyl-1H-inden-3-yl)amino]-

3-((1-Oxo-2-phenylinden-3-yl)amino)benzoic acid

CAS: 937605-28-2

Please enquire for more information about 3-((1-Oxo-2-phenylinden-3-yl)amino)benzoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₂H₁₅NO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 341.36 g/mol

Ref: 3D-FO168965