CAS 937605-32-8

3-[[4-(Trifluoromethoxy)phenyl]amino]-2-cyclohexen-1-one

Description:

3-[[4-(Trifluoromethoxy)phenyl]amino]-2-cyclohexen-1-one, with the CAS number 937605-32-8, is an organic compound characterized by its unique structural features, including a cyclohexenone core and a trifluoromethoxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The cyclohexenone moiety can participate in various chemical reactions, including Michael additions and conjugate additions, due to its electrophilic nature. Additionally, the compound's molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its physical properties, such as solubility and melting point, would depend on the specific conditions and solvent used. Overall, this compound represents a versatile structure with potential implications in various chemical and biological contexts.

Formula: C₁₃H₁₂F₃NO₂

InChI: InChI=1S/C13H12F3NO2/c14-13(15,16)19-12-6-4-9(5-7-12)17-10-2-1-3-11(18)8-10/h4-8,17H,1-3H2

InChI key: InChIKey=SIDCZORKYMGDDV-UHFFFAOYSA-N

SMILES: N(C1=CC=C(OC(F)(F)F)C=C1)C2=CC(=O)CCC2

Synonyms:

• 3-[[4-(Trifluoromethoxy)phenyl]amino]-2-cyclohexen-1-one
• 2-Cyclohexen-1-one, 3-[[4-(trifluoromethoxy)phenyl]amino]-

3-((4-(Trifluoromethoxy)phenyl)amino)cyclohex-2-en-1-one

CAS: 937605-32-8

Please enquire for more information about 3-((4-(Trifluoromethoxy)phenyl)amino)cyclohex-2-en-1-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₁₂F₃NO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 271.24 g/mol

Ref: 3D-FT168978