CAS 937605-64-6

3-Cyclopropyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description:

3-Cyclopropyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazolo[3,4-b]pyridine core fused with a cyclopropyl group. This compound features an acetic acid functional group, contributing to its potential as a bioactive molecule. The presence of the cyclopropyl moiety may influence its pharmacological properties, such as binding affinity and selectivity towards biological targets. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic and aliphatic components, which can affect its solubility and permeability in biological systems. Additionally, the pyrazole ring may impart specific reactivity and stability characteristics, making it of interest in medicinal chemistry for the development of therapeutic agents. Its CAS number, 937605-64-6, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications in research and drug development.

Formula: C₁₁H₁₁N₃O₂

InChI: InChI=1S/C11H11N3O2/c15-9(16)6-14-11-8(2-1-5-12-11)10(13-14)7-3-4-7/h1-2,5,7H,3-4,6H2,(H,15,16)

InChI key: InChIKey=XDJRMHRPJVGPIW-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1N=C(C=2C1=NC=CC2)C3CC3

Synonyms:

• 3-Cyclopropyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid
• 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 3-cyclopropyl-