CAS 937605-81-7

3-Chloro-2-(2-furanylmethoxy)benzenamine

Description:

3-Chloro-2-(2-furanylmethoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a chloro substituent and a furanylmethoxy group. The presence of the chloro group introduces a halogen, which can influence the compound's reactivity and solubility. The furanylmethoxy moiety contributes to the compound's potential biological activity, as furan derivatives are often associated with various pharmacological properties. This compound may exhibit properties such as moderate to high lipophilicity due to the aromatic and furan rings, which can affect its interaction with biological membranes. Additionally, the amine functional group can participate in hydrogen bonding, influencing its solubility in polar solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, 3-Chloro-2-(2-furanylmethoxy)benzenamine represents a unique chemical entity with potential utility in various chemical and biological contexts.

Formula: C₁₁H₁₀ClNO₂

InChI: InChI=1S/C11H10ClNO2/c12-9-4-1-5-10(13)11(9)15-7-8-3-2-6-14-8/h1-6H,7,13H2

InChI key: InChIKey=DIRSBSHSOLYJAP-UHFFFAOYSA-N

SMILES: O(CC1=CC=CO1)C2=C(Cl)C=CC=C2N

Synonyms:

• 3-Chloro-2-(2-furanylmethoxy)benzenamine
• Benzenamine, 3-chloro-2-(2-furanylmethoxy)-