CAS 937605-90-8

6-(2-Methoxyphenyl)-3-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description:

6-(2-Methoxyphenyl)-3-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid, with the CAS number 937605-90-8, is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core. This compound features a methoxyphenyl group and a trifluoromethyl substituent, contributing to its unique chemical properties. It is typically classified as an organic acid due to the presence of the acetic acid functional group. The trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The presence of the pyrazole ring suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or analgesic properties. Additionally, the methoxy group can affect the compound's solubility and reactivity. Overall, this compound's structural features suggest it may exhibit significant biological activity, warranting further investigation in drug development and related fields.

Formula: C₁₇H₁₄F₃N₃O₃

InChI: InChI=1S/C17H14F3N3O3/c1-9-15-11(17(18,19)20)7-12(10-5-3-4-6-13(10)26-2)21-16(15)23(22-9)8-14(24)25/h3-7H,8H2,1-2H3,(H,24,25)

InChI key: InChIKey=XVXRAZANTRWKRM-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=2C(=C(C(F)(F)F)C=C(N2)C3=C(OC)C=CC=C3)C(C)=N1

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 6-(2-methoxyphenyl)-3-methyl-4-(trifluoromethyl)-
• 6-(2-Methoxyphenyl)-3-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

2-[6-(2-Methoxyphenyl)-3-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-1-yl]acetic acid

CAS: 937605-90-8

Versatile small molecule scaffold

Formula: C₁₇H₁₄F₃N₃O₃

Purity: Min. 95%

Molecular weight: 365.31 g/mol

Ref: 3D-MMB60590