CAS 937606-04-7

3-Cyclopropyl-6-(2-furanyl)-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description:

3-Cyclopropyl-6-(2-furanyl)-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core fused with a cyclopropyl group and a furanyl substituent. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit unique pharmacological properties due to its structural features, making it of interest in medicinal chemistry. The acetic acid functional group suggests potential for interactions with biological targets, possibly influencing its solubility and reactivity. Its CAS number, 937606-04-7, allows for easy identification in chemical databases. Overall, this compound's distinctive features may contribute to its utility in research and development, particularly in the fields of drug discovery and development, where such heterocyclic compounds are often explored for therapeutic applications.

Formula: C₁₆H₁₂F₃N₃O₃

InChI: InChI=1S/C16H12F3N3O3/c17-16(18,19)9-6-10(11-2-1-5-25-11)20-15-13(9)14(8-3-4-8)21-22(15)7-12(23)24/h1-2,5-6,8H,3-4,7H2,(H,23,24)

InChI key: InChIKey=RVLZIWXLCPBRQH-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C2C(N(CC(O)=O)N=C2C3CC3)=NC(=C1)C4=CC=CO4

Synonyms:

• 3-Cyclopropyl-6-(2-furanyl)-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid
• 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 3-cyclopropyl-6-(2-furanyl)-4-(trifluoromethyl)-