CAS 937606-29-6

5-Chloro-2-(2,4-dimethylphenoxy)benzenamine

Description:

5-Chloro-2-(2,4-dimethylphenoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a chloro substituent and an amine functional group. The presence of the chloro group indicates that it may exhibit reactivity typical of halogenated compounds, potentially participating in nucleophilic substitution reactions. The dimethylphenoxy moiety contributes to its hydrophobic characteristics, which may influence its solubility in organic solvents rather than in water. This compound may also exhibit biological activity due to the amine group, which can engage in hydrogen bonding and interact with various biological targets. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its properties and biological effects. Safety data should be consulted to understand its toxicity and handling requirements, as compounds with similar structures can vary widely in their safety profiles. Overall, 5-Chloro-2-(2,4-dimethylphenoxy)benzenamine represents a complex organic molecule with potential utility in various chemical applications.

Formula: C₁₄H₁₄ClNO

InChI: InChI=1S/C14H14ClNO/c1-9-3-5-13(10(2)7-9)17-14-6-4-11(15)8-12(14)16/h3-8H,16H2,1-2H3

InChI key: InChIKey=NMMSDCGRGSGISH-UHFFFAOYSA-N

SMILES: O(C1=C(C)C=C(C)C=C1)C2=C(N)C=C(Cl)C=C2

Synonyms:

• 5-Chloro-2-(2,4-dimethylphenoxy)benzenamine
• Benzenamine, 5-chloro-2-(2,4-dimethylphenoxy)-