
CAS 937606-31-0
:5-Chloro-2-(3-methoxyphenoxy)benzenamine
Description:
5-Chloro-2-(3-methoxyphenoxy)benzenamine, with the CAS number 937606-31-0, is an organic compound characterized by its aromatic structure, which includes a chloro substituent and an amine group. This compound features a chloro group at the 5-position of a benzene ring and a methoxyphenoxy group at the 2-position, contributing to its potential as a bioactive molecule. The presence of the amine group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. The methoxy group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would typically involve standard organic reactions, and its stability would depend on environmental conditions such as temperature and pH. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C13H12ClNO2
InChI:InChI=1S/C13H12ClNO2/c1-16-10-3-2-4-11(8-10)17-13-6-5-9(14)7-12(13)15/h2-8H,15H2,1H3
InChI key:InChIKey=FXFJQBAQYFXCBZ-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=C(Cl)C=C1)C2=CC(OC)=CC=C2
Synonyms:- Benzenamine, 5-chloro-2-(3-methoxyphenoxy)-
- 5-Chloro-2-(3-methoxyphenoxy)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.