CAS 937606-37-6

4-(3-Methoxyphenyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description:

4-(3-Methoxyphenyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core fused with a methoxyphenyl group and an acetic acid moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its unique arrangement of functional groups. The presence of the methoxy group may enhance lipophilicity and influence its interaction with biological targets. As a pyrazole derivative, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. The acetic acid functional group can contribute to its solubility and reactivity, potentially allowing for various chemical modifications. Overall, this compound's characteristics suggest it may have applications in drug development or as a research tool in studying specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₆H₁₅N₃O₃

InChI: InChI=1S/C16H15N3O3/c1-10-15-13(11-4-3-5-12(8-11)22-2)6-7-17-16(15)19(18-10)9-14(20)21/h3-8H,9H2,1-2H3,(H,20,21)

InChI key: InChIKey=OYHZKVXKHLERFI-UHFFFAOYSA-N

SMILES: CC=1C=2C(N(CC(O)=O)N1)=NC=CC2C3=CC(OC)=CC=C3

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 4-(3-methoxyphenyl)-3-methyl-
• 4-(3-Methoxyphenyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

2-[4-(3-Methoxyphenyl)-3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl]acetic acid

CAS: 937606-37-6

Versatile small molecule scaffold

Formula: C₁₆H₁₅N₃O₃

Purity: Min. 95%

Molecular weight: 297.31 g/mol

Ref: 3D-MMB60637