CAS 937606-76-3
:1-(5-Nitro-2-pyridinyl)-3-piperidinecarboxylic acid
Description:
1-(5-Nitro-2-pyridinyl)-3-piperidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a piperidine ring and a nitro-substituted pyridine moiety. This compound typically exhibits properties associated with both its aromatic and aliphatic components, such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The nitro group contributes to its potential reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The presence of the piperidine ring suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting neurological or psychiatric conditions. Additionally, the compound's molecular structure may allow for various synthetic modifications, enhancing its utility in research and drug development. Overall, 1-(5-Nitro-2-pyridinyl)-3-piperidinecarboxylic acid represents a versatile scaffold for further exploration in chemical and biological contexts.
Formula:C11H13N3O4
InChI:InChI=1S/C11H13N3O4/c15-11(16)8-2-1-5-13(7-8)10-4-3-9(6-12-10)14(17)18/h3-4,6,8H,1-2,5,7H2,(H,15,16)
InChI key:InChIKey=JKTHVFRONFGBAF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CN(CCC1)C2=CC=C(N(=O)=O)C=N2
Synonyms:- 1-(5-Nitro-2-pyridinyl)-3-piperidinecarboxylic acid
- 3-Piperidinecarboxylic acid, 1-(5-nitro-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
