CAS 937606-77-4
:4-(2,2-Difluoroethoxy)benzenamine
Description:
4-(2,2-Difluoroethoxy)benzenamine is an organic compound characterized by its aromatic amine structure, which features a benzene ring substituted with an amine group and a difluoroethoxy group. The presence of the difluoroethoxy moiety introduces significant polarity and can influence the compound's solubility and reactivity. This compound is likely to exhibit properties typical of aromatic amines, such as being a potential nucleophile due to the lone pair of electrons on the nitrogen atom. The difluoroethyl group can enhance the compound's electronic properties, potentially affecting its reactivity in various chemical reactions, including electrophilic aromatic substitution. Additionally, the fluorine atoms can impart unique characteristics, such as increased lipophilicity and altered hydrogen bonding capabilities. The compound may find applications in pharmaceuticals, agrochemicals, or materials science, where its specific functional groups can be utilized for targeted interactions or modifications. Safety and handling considerations should be taken into account due to the presence of the amine group, which can be hazardous in certain contexts.
Formula:C8H9F2NO
InChI:InChI=1S/C8H9F2NO/c9-8(10)5-12-7-3-1-6(11)2-4-7/h1-4,8H,5,11H2
InChI key:InChIKey=LJBLGEVQJBDSGH-UHFFFAOYSA-N
SMILES:O(CC(F)F)C1=CC=C(N)C=C1
Synonyms:- 4-(2,2-Difluoroethoxy)benzenamine
- Benzenamine, 4-(2,2-difluoroethoxy)-
- 4-(2,2-Difluoroethoxy)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
