CAS 937607-09-5

6-Cyclopropyl-4-(difluoromethyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description:

6-Cyclopropyl-4-(difluoromethyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid is a chemical compound characterized by its unique pyrazolo-pyridine structure, which incorporates a cyclopropyl group and a difluoromethyl substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the difluoromethyl group may enhance its metabolic stability and influence its interaction with biological targets. The carboxylic acid functional group suggests potential for forming salts or esters, which can affect its pharmacokinetic properties. Additionally, the compound's structural features may contribute to its ability to modulate specific biological pathways, making it a candidate for further investigation in drug development. Overall, the characteristics of this compound highlight its potential utility in medicinal chemistry, particularly in the context of developing novel therapeutic agents.

Formula: C₁₃H₁₃F₂N₃O₂

InChI: InChI=1S/C13H13F2N3O2/c1-6-11-8(12(14)15)4-9(7-2-3-7)16-13(11)18(17-6)5-10(19)20/h4,7,12H,2-3,5H2,1H3,(H,19,20)

InChI key: InChIKey=VNGYOHIYCCCVLE-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=2C(=C(C(F)F)C=C(N2)C3CC3)C(C)=N1

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 6-cyclopropyl-4-(difluoromethyl)-3-methyl-
• 6-Cyclopropyl-4-(difluoromethyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid