CymitQuimica logo

CAS 937607-10-8

:

4-(Difluoromethyl)-6-(2-furanyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description:
4-(Difluoromethyl)-6-(2-furanyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyridine core fused with a furan ring and a difluoromethyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its unique functional groups. The presence of the difluoromethyl group may enhance lipophilicity and influence the compound's interaction with biological targets. The carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit solubility in polar solvents. Additionally, the compound's structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 937607-10-8, allows for precise identification in chemical databases, facilitating research and development in various applications, including drug discovery and development. Overall, this compound represents a class of molecules that could have significant implications in pharmaceutical research.
Formula:C14H11F2N3O3
InChI:InChI=1S/C14H11F2N3O3/c1-7-12-8(13(15)16)5-9(10-3-2-4-22-10)17-14(12)19(18-7)6-11(20)21/h2-5,13H,6H2,1H3,(H,20,21)
InChI key:InChIKey=OZYBAKLSZHDYPR-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C=2C(=C(C(F)F)C=C(N2)C3=CC=CO3)C(C)=N1
Synonyms:
  • 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 4-(difluoromethyl)-6-(2-furanyl)-3-methyl-
  • 4-(Difluoromethyl)-6-(2-furanyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.