CAS 937607-18-6

4-(Difluoromethyl)-6-(4-methoxyphenyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description:

4-(Difluoromethyl)-6-(4-methoxyphenyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid, with the CAS number 937607-18-6, is a synthetic organic compound characterized by its complex pyrazolo-pyridine structure. This compound features a difluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The presence of a methoxyphenyl group contributes to its aromatic character, potentially affecting its interaction with biological targets. The acetic acid moiety suggests that it may exhibit acidic properties, which can influence solubility and reactivity in various environments. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, including anti-inflammatory or anticancer activities. Its unique structural features may allow for specific interactions with biological macromolecules, making it a candidate for further research in drug development. As with many synthetic compounds, understanding its stability, solubility, and reactivity under different conditions is crucial for its application in pharmaceutical contexts.

Formula: C₁₇H₁₅F₂N₃O₃

InChI: InChI=1S/C17H15F2N3O3/c1-9-15-12(16(18)19)7-13(10-3-5-11(25-2)6-4-10)20-17(15)22(21-9)8-14(23)24/h3-7,16H,8H2,1-2H3,(H,23,24)

InChI key: InChIKey=HWGHIJUPXHPAKY-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=2C(=C(C(F)F)C=C(N2)C3=CC=C(OC)C=C3)C(C)=N1

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 4-(difluoromethyl)-6-(4-methoxyphenyl)-3-methyl-
• 4-(Difluoromethyl)-6-(4-methoxyphenyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

2-[4-(Difluoromethyl)-6-(4-methoxyphenyl)-3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl]acetic acid

CAS: 937607-18-6

Versatile small molecule scaffold

Formula: C₁₇H₁₅F₂N₃O₃

Purity: Min. 95%

Molecular weight: 347.32 g/mol

Ref: 3D-MMB60718