CAS 937607-23-3

3,6-Dicyclopropyl-4-(difluoromethyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description:

3,6-Dicyclopropyl-4-(difluoromethyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid is a chemical compound characterized by its unique pyrazolo-pyridine structure, which incorporates both cyclopropyl groups and a difluoromethyl substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the difluoromethyl group can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the dicyclopropyl moiety may contribute to steric hindrance, affecting the compound's conformation and reactivity. As an acetic acid derivative, it may also exhibit acidic properties, which can be relevant in various chemical reactions and biological interactions. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.

Formula: C₁₅H₁₅F₂N₃O₂

InChI: InChI=1S/C15H15F2N3O2/c16-14(17)9-5-10(7-1-2-7)18-15-12(9)13(8-3-4-8)19-20(15)6-11(21)22/h5,7-8,14H,1-4,6H2,(H,21,22)

InChI key: InChIKey=LBZRFWDWIORPRA-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C2C(N(CC(O)=O)N=C2C3CC3)=NC(=C1)C4CC4

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 3,6-dicyclopropyl-4-(difluoromethyl)-
• 3,6-Dicyclopropyl-4-(difluoromethyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

2-[3,6-Dicyclopropyl-4-(difluoromethyl)-1H-pyrazolo[3,4-b]pyridin-1-yl]acetic acid

CAS: 937607-23-3

Versatile small molecule scaffold

Formula: C₁₅H₁₅F₂N₃O₂

Purity: Min. 95%

Molecular weight: 307.29 g/mol

Ref: 3D-MMB60723