CAS 937607-24-4

3-Cyclopropyl-4-(difluoromethyl)-6-(2-furanyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description:

3-Cyclopropyl-4-(difluoromethyl)-6-(2-furanyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core fused with a cyclopropyl group and a difluoromethyl substituent. The presence of a furanyl group adds to its aromatic character, potentially influencing its reactivity and interactions. This compound is likely to exhibit unique pharmacological properties due to its specific functional groups, which may affect its solubility, stability, and biological activity. The acetic acid moiety suggests potential for ionization, impacting its behavior in biological systems. As a member of the pyrazole family, it may be investigated for various applications, including medicinal chemistry, where such compounds are often explored for their therapeutic potential. The CAS number 937607-24-4 serves as a unique identifier for this substance, facilitating its recognition in chemical databases and literature. Overall, the compound's structural features suggest a diverse range of chemical properties and potential applications in research and development.

Formula: C₁₆H₁₃F₂N₃O₃

InChI: InChI=1S/C16H13F2N3O3/c17-15(18)9-6-10(11-2-1-5-24-11)19-16-13(9)14(8-3-4-8)20-21(16)7-12(22)23/h1-2,5-6,8,15H,3-4,7H2,(H,22,23)

InChI key: InChIKey=FUZNUGNPGICNDI-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C2C(N(CC(O)=O)N=C2C3CC3)=NC(=C1)C4=CC=CO4

Synonyms:

• 3-Cyclopropyl-4-(difluoromethyl)-6-(2-furanyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid
• 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 3-cyclopropyl-4-(difluoromethyl)-6-(2-furanyl)-