CAS 937607-32-4
:3-Cyclopropyl-4-(difluoromethyl)-6-(4-methoxyphenyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid
Description:
3-Cyclopropyl-4-(difluoromethyl)-6-(4-methoxyphenyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid is a synthetic organic compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core. This compound features a cyclopropyl group and a difluoromethyl substituent, contributing to its unique reactivity and potential biological activity. The presence of a methoxyphenyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. As an acetic acid derivative, it likely exhibits acidic behavior, which can affect its solubility and interaction with biological targets. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific pathways or receptors. Its CAS number, 937607-32-4, allows for precise identification in chemical databases and literature. Overall, this compound's distinctive features make it a subject of interest for further research in drug discovery and development.
Formula:C19H17F2N3O3
InChI:InChI=1S/C19H17F2N3O3/c1-27-12-6-4-10(5-7-12)14-8-13(18(20)21)16-17(11-2-3-11)23-24(9-15(25)26)19(16)22-14/h4-8,11,18H,2-3,9H2,1H3,(H,25,26)
InChI key:InChIKey=FUUJNGVUNBCQHX-UHFFFAOYSA-N
SMILES:C(F)(F)C1=C2C(N(CC(O)=O)N=C2C3CC3)=NC(=C1)C4=CC=C(OC)C=C4
Synonyms:- 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 3-cyclopropyl-4-(difluoromethyl)-6-(4-methoxyphenyl)-
- 3-Cyclopropyl-4-(difluoromethyl)-6-(4-methoxyphenyl)-1H-pyrazolo[3,4-b]pyridine-1-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.