
CAS 937612-32-3
:2-[[(1,1-Dimethylethoxy)carbonyl]amino]-2,3-dihydro-5-nitro-1H-indene-2-carboxylic acid
Description:
2-[[(1,1-Dimethylethoxy)carbonyl]amino]-2,3-dihydro-5-nitro-1H-indene-2-carboxylic acid is a chemical compound characterized by its complex structure, which includes an indene core, a nitro group, and a carboxylic acid functional group. The presence of the dimethylethoxycarbonyl group indicates that it has protective or modifying functionalities, often used in organic synthesis to enhance solubility or stability. This compound is likely to exhibit moderate to high polarity due to the carboxylic acid and nitro groups, which can engage in hydrogen bonding and ionic interactions. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. The compound's reactivity may be influenced by the electron-withdrawing nature of the nitro group, which can affect its behavior in chemical reactions. Overall, this substance represents a unique combination of functional groups that may provide interesting properties for further research and application in various chemical contexts.
Formula:C15H18N2O6
InChI:InChI=1S/C15H18N2O6/c1-14(2,3)23-13(20)16-15(12(18)19)7-9-4-5-11(17(21)22)6-10(9)8-15/h4-6H,7-8H2,1-3H3,(H,16,20)(H,18,19)
InChI key:InChIKey=RPBYNSMRQXWNFS-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1(C(O)=O)CC=2C(C1)=CC=C(N(=O)=O)C2
Synonyms:- 2-[[(1,1-Dimethylethoxy)carbonyl]amino]-2,3-dihydro-5-nitro-1H-indene-2-carboxylic acid
- 1H-Indene-2-carboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-2,3-dihydro-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.