CAS 93762-15-3

2-Acetyl-4-hydroxy-3-methoxybenzoic acid

Description:

2-Acetyl-4-hydroxy-3-methoxybenzoic acid, with the CAS number 93762-15-3, is an organic compound that belongs to the class of benzoic acids. It features a benzoic acid core substituted with an acetyl group at the 2-position, a hydroxy group at the 4-position, and a methoxy group at the 3-position. This compound is characterized by its aromatic structure, which contributes to its chemical stability and potential reactivity. The presence of the hydroxy and methoxy groups enhances its solubility in polar solvents and may influence its biological activity. It may exhibit properties such as antioxidant activity or potential use in pharmaceuticals due to its structural features. Additionally, the compound's functional groups can participate in various chemical reactions, making it a candidate for further synthetic modifications. Its applications may extend to fields such as medicinal chemistry, where derivatives of similar compounds are often explored for therapeutic uses. Overall, 2-Acetyl-4-hydroxy-3-methoxybenzoic acid represents a versatile structure in organic chemistry.

Formula: C₁₀H₁₀O₅

InChI: InChI=1S/C10H10O5/c1-5(11)8-6(10(13)14)3-4-7(12)9(8)15-2/h3-4,12H,1-2H3,(H,13,14)

InChI key: InChIKey=GMYHGDFFXVALJH-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(OC)C(O)=CC=C1C(O)=O

Synonyms:

• 2-Acetyl-4-hydroxy-3-methoxybenzoic acid
• Benzoic acid, 2-acetyl-4-hydroxy-3-methoxy-