CAS 93762-17-5

N,N,2,2,4-Pentamethylpentanamide

Description:

N,N,2,2,4-Pentamethylpentanamide, with the CAS number 93762-17-5, is an organic compound characterized by its amide functional group, which is derived from pentanamide. This compound features a branched alkyl chain, specifically a pentane backbone with five methyl groups attached at various positions, contributing to its unique structure and properties. The presence of multiple methyl groups enhances its steric bulk and can influence its physical properties, such as boiling point and solubility. Typically, amides like this one exhibit moderate polarity due to the carbonyl group, which can engage in hydrogen bonding. This compound may be used in various applications, including as a solvent, reagent, or in the synthesis of other chemical compounds. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be influenced by the arrangement of the methyl groups. Safety data and handling precautions should be consulted when working with this compound, as with any chemical substance.

Formula: C₁₀H₂₁NO

InChI: InChI=1S/C10H21NO/c1-8(2)7-10(3,4)9(12)11(5)6/h8H,7H2,1-6H3

InChI key: InChIKey=DDOZFENEPXDBJR-UHFFFAOYSA-N

SMILES: C(C(N(C)C)=O)(CC(C)C)(C)C

Synonyms:

• N,N,2,2,4-Pentamethylpentanamide
• Pentanamide, N,N,2,2,4-pentamethyl-