CAS 93762-24-4

2,3-Dihydroxypropyl 5-hydroxydodecanoate

Description:

2,3-Dihydroxypropyl 5-hydroxydodecanoate, with the CAS number 93762-24-4, is an ester derived from dodecanoic acid and a glycerol derivative. This compound features two hydroxyl groups on the propyl chain, which contribute to its hydrophilicity and potential for forming hydrogen bonds. The presence of the dodecanoate moiety imparts fatty acid characteristics, making it relatively hydrophobic. This dual nature allows it to function effectively in various applications, including as an emulsifier or surfactant in cosmetic and pharmaceutical formulations. The compound is likely to exhibit moderate solubility in organic solvents while being less soluble in water due to its long hydrophobic tail. Additionally, the hydroxyl groups enhance its reactivity, making it suitable for further chemical modifications. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate potential risks associated with its use. Overall, 2,3-Dihydroxypropyl 5-hydroxydodecanoate is a versatile compound with applications in various fields, particularly in formulations requiring emulsification or stabilization.

Formula: C₁₅H₃₀O₅

InChI: InChI=1S/C15H30O5/c1-2-3-4-5-6-8-13(17)9-7-10-15(19)20-12-14(18)11-16/h13-14,16-18H,2-12H2,1H3

InChI key: InChIKey=KCEQGTJBAICOKH-UHFFFAOYSA-N

SMILES: C(CC(OCC(CO)O)=O)CC(CCCCCCC)O

Synonyms:

• 2,3-Dihydroxypropyl 5-hydroxylaurate
• Dodecanoic acid, 5-hydroxy-, 2,3-dihydroxypropyl ester
• 2,3-Dihydroxypropyl 5-hydroxydodecanoate
• 2,3-Dihydroxypropyl 5-hydroxydodecanoate
• 5-Hydroxydodecanoic acid 2,3-dihydroxypropyl ester
• Einecs 297-738-0