CAS 93762-35-7
:Pentyl 3-(methylthio)propanoate
Description:
Pentyl 3-(methylthio)propanoate, with the CAS number 93762-35-7, is an ester compound characterized by its fruity odor, which is typical of many esters. It is formed from the reaction of pentanol and 3-(methylthio)propanoic acid. This compound is typically a colorless to pale yellow liquid and is soluble in organic solvents, while being less soluble in water due to its hydrophobic nature. Its molecular structure includes a pentyl group, which contributes to its volatility and aroma, making it of interest in flavor and fragrance applications. The presence of the methylthio group can impart unique sensory properties, enhancing its use in various formulations. Pentyl 3-(methylthio)propanoate may also exhibit low toxicity, but like many chemical substances, it should be handled with care, following appropriate safety guidelines. Its applications can extend to food flavoring, perfumery, and potentially in the synthesis of other chemical compounds.
Formula:C9H18O2S
InChI:InChI=1S/C9H18O2S/c1-3-4-5-7-11-9(10)6-8-12-2/h3-8H2,1-2H3
InChI key:InChIKey=VSCXQPTWKZWPQB-UHFFFAOYSA-N
SMILES:O(C(CCSC)=O)CCCCC
Synonyms:- 3-Methylbutyl 3-(Methylsulfanyl)Propanoate
- Isopentyl 3-(methylthio)propionate~3-Methylbutyl 3-(methylthio)propionate
- Pentyl 3-(Methylsulfanyl)Propanoate
- Pentyl 3-(methylthio)propanoate
- Propanoic acid, 3-(methylthio)-, pentyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
