CAS 937638-36-3
:N-methyl-1-(3-methylpyridin-2-yl)propan-2-amine
Description:
N-methyl-1-(3-methylpyridin-2-yl)propan-2-amine, identified by its CAS number 937638-36-3, is a chemical compound that belongs to the class of amines. It features a propan-2-amine backbone with a methyl group and a 3-methylpyridine moiety, which contributes to its unique properties. This compound is characterized by its nitrogen-containing functional group, which can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of the amine group, making them soluble in polar solvents. The presence of the pyridine ring can also impart basicity and influence the compound's interaction with biological systems, potentially affecting its pharmacological properties. Additionally, the methyl groups can enhance lipophilicity, which may affect the compound's distribution in biological environments. Overall, N-methyl-1-(3-methylpyridin-2-yl)propan-2-amine is of interest in various fields, including medicinal chemistry and materials science, due to its structural features and potential applications.
Formula:C10H16N2
InChI:InChI=1/C10H16N2/c1-8-5-4-6-12-10(8)7-9(2)11-3/h4-6,9,11H,7H2,1-3H3
SMILES:Cc1cccnc1CC(C)NC
Synonyms:- 2-pyridineethanamine, N,α,3-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.