CymitQuimica logo

CAS 937647-22-8

:

5-bromo-2-(methylamino)pyrimidine-4-carboxylic acid

Description:
5-Bromo-2-(methylamino)pyrimidine-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position and a methylamino group at the 2-position contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 4-position enhances its solubility in polar solvents and allows for potential interactions in biochemical pathways. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can influence binding affinity and selectivity for biological targets. Additionally, the presence of both halogen and amino groups suggests potential for further derivatization, making it a versatile intermediate in organic synthesis. Its CAS number, 937647-22-8, provides a unique identifier for regulatory and safety information.
Formula:C6H6BrN3O2
InChI:InChI=1/C6H6BrN3O2/c1-8-6-9-2-3(7)4(10-6)5(11)12/h2H,1H3,(H,11,12)(H,8,9,10)
SMILES:CN=c1[nH]cc(c(C(=O)O)n1)Br
Synonyms:
  • 4-Pyrimidinecarboxylic Acid, 5-Bromo-2-(Methylamino)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.