CymitQuimica logo

CAS 93765-24-3

:

2H-Pyrido[3,2-b]-1,4-oxazin-3-amine

Description:
2H-Pyrido[3,2-b]-1,4-oxazin-3-amine is a heterocyclic organic compound characterized by a fused ring system that includes a pyridine and an oxazine moiety. This compound features an amine functional group, which contributes to its potential reactivity and solubility in various solvents. The presence of nitrogen atoms in the structure enhances its basicity and may influence its interaction with biological systems, making it of interest in medicinal chemistry. The compound's unique structure may impart specific pharmacological properties, potentially allowing it to act as a ligand or inhibitor in biochemical pathways. Additionally, its stability and reactivity can be influenced by the substituents on the rings, which can affect its synthesis and application in various chemical reactions. Overall, 2H-Pyrido[3,2-b]-1,4-oxazin-3-amine represents a class of compounds that may have diverse applications in pharmaceuticals, agrochemicals, and materials science, warranting further investigation into its properties and potential uses.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c8-6-4-11-5-2-1-3-9-7(5)10-6/h1-3H,4H2,(H2,8,9,10)
InChI key:InChIKey=ZAUWLQGVFJGKDL-UHFFFAOYSA-N
SMILES:NC1=NC=2C(OC1)=CC=CN2
Synonyms:
  • 2H-Pyrido[3,2-b]-1,4-oxazin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.