CymitQuimica logo

CAS 93765-83-4

:

Benzene, 1-bromo-5-chloro-2-fluoro-4-methyl-

Description:
Benzene, 1-bromo-5-chloro-2-fluoro-4-methyl- is an organic compound characterized by a benzene ring substituted with various halogen and alkyl groups. The presence of bromine, chlorine, and fluorine atoms, along with a methyl group, contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative halogen substituents, which can influence its reactivity and solubility in different solvents. The specific arrangement of these substituents on the benzene ring can affect its reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of multiple halogens may enhance its potential applications in organic synthesis and materials science. Safety considerations are important, as halogenated compounds can pose health risks and environmental concerns. Overall, Benzene, 1-bromo-5-chloro-2-fluoro-4-methyl- is a complex molecule with diverse chemical behavior, making it of interest in various fields, including pharmaceuticals and agrochemicals.
Formula:C7H5BrClF
InChI:InChI=1S/C7H5BrClF/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,1H3
InChI key:GYFUSHKOOPPODA-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1Cl)Br)F
Synonyms:
  • 4-Bromo-2-chloro-5-fluorotoluene
  • 2-Chloro-4-bromo-5-fluorotoluene
Found 4 products.