CymitQuimica logo

CAS 937650-37-8

:

(2-Tricyclo[3.3.1.13,7]dec-1-ylethyl)hydrazine

Description:
(2-Tricyclo[3.3.1.13,7]dec-1-ylethyl)hydrazine, identified by its CAS number 937650-37-8, is a chemical compound characterized by its unique structural framework, which includes a tricyclic decane moiety and a hydrazine functional group. This compound features a hydrazine (-NH-NH2) group, which is known for its reactivity and potential applications in various chemical reactions, including as a reducing agent or in the synthesis of other nitrogen-containing compounds. The tricyclic structure contributes to its rigidity and may influence its physical properties, such as melting and boiling points, solubility, and stability. Additionally, compounds with hydrazine groups can exhibit biological activity, making them of interest in medicinal chemistry. However, the specific characteristics, such as reactivity, toxicity, and potential applications, would require further investigation through experimental data and literature review, as they can vary significantly based on the compound's environment and formulation.
Formula:C12H22N2
InChI:InChI=1S/C12H22N2/c13-14-2-1-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11,14H,1-8,13H2
InChI key:InChIKey=DUCSBHMQZWKCDF-UHFFFAOYSA-N
SMILES:C(CNN)C12CC3CC(C1)CC(C2)C3
Synonyms:
  • (2-Tricyclo[3.3.1.13,7]dec-1-ylethyl)hydrazine
  • Hydrazine, (2-tricyclo[3.3.1.13,7]dec-1-ylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.