CAS 937650-43-6

N4-Ethyl-N1,N1-dimethyl-1,4-benzenedimethanamine

Description:

N4-Ethyl-N1,N1-dimethyl-1,4-benzenedimethanamine, identified by its CAS number 937650-43-6, is a chemical compound that belongs to the class of amines. This substance features a complex structure characterized by a benzene ring substituted with two dimethylamino groups and an ethyl group. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of multiple functional groups may impart unique reactivity and solubility properties, making it suitable for specific chemical reactions or as an intermediate in the synthesis of more complex molecules. As with many amines, it may exhibit basicity and can participate in hydrogen bonding, influencing its physical properties such as boiling point and solubility in polar solvents. Safety data and handling precautions should be consulted, as amines can be hazardous and may require specific storage conditions to maintain stability and prevent degradation. Overall, this compound's characteristics make it a subject of interest in chemical research and development.

Formula: C₁₂H₂₀N₂

InChI: InChI=1S/C12H20N2/c1-4-13-9-11-5-7-12(8-6-11)10-14(2)3/h5-8,13H,4,9-10H2,1-3H3

InChI key: InChIKey=YRIUBFPRWAORJI-UHFFFAOYSA-N

SMILES: C(N(C)C)C1=CC=C(CNCC)C=C1

Synonyms:

• 1,4-Benzenedimethanamine, N4-ethyl-N1,N1-dimethyl-
• N4-Ethyl-N1,N1-dimethyl-1,4-benzenedimethanamine

({4-[(Ethylamino)methyl]phenyl}methyl)dimethylamine

CAS: 937650-43-6

Versatile small molecule scaffold

Formula: C₁₂H₂₀N₂

Purity: Min. 95%

Molecular weight: 192.3 g/mol

Ref: 3D-MMB65043