CAS 937653-39-9
:3-(2-ethoxyphenyl)propan-1-amine
Description:
3-(2-Ethoxyphenyl)propan-1-amine, identified by its CAS number 937653-39-9, is an organic compound characterized by its amine functional group and an ethoxy-substituted phenyl ring. This compound features a propan-1-amine backbone, which contributes to its basicity and potential reactivity. The presence of the ethoxy group enhances its lipophilicity, potentially influencing its solubility in organic solvents and biological membranes. The compound may exhibit various chemical properties, including the ability to participate in hydrogen bonding due to the amine group, which can affect its interactions in biological systems. Additionally, its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a building block for more complex molecules. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or literature review. Overall, 3-(2-ethoxyphenyl)propan-1-amine represents a compound of interest in organic synthesis and medicinal applications.
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-2-13-11-8-4-3-6-10(11)7-5-9-12/h3-4,6,8H,2,5,7,9,12H2,1H3
SMILES:CCOc1ccccc1CCCN
Synonyms:- Benzenepropanamine, 2-Ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
